C15H19F3N2O2 — CID 172581663
methyl 4-[[2-methyl-4-(trifluoromethyl)pyrimidin-5-yl]methyl]cyclohexane-1-carboxylate (PubChem CID 172581663) has the molecular formula C15H19F3N2O2 and a molecular weight of 316.32 g/mol. Its IUPAC name is methyl 4-[[2-methyl-4-(trifluoromethyl)pyrimidin-5-yl]methyl]cyclohexane-1-carboxylate.
| Compound Name | methyl 4-[[2-methyl-4-(trifluoromethyl)pyrimidin-5-yl]methyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 172581663 |
| Molecular Formula | C15H19F3N2O2 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | methyl 4-[[2-methyl-4-(trifluoromethyl)pyrimidin-5-yl]methyl]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(Cc2cnc(C)nc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H19F3N2O2/c1-9-19-8-12(13(20-9)15(16,17)18)7-10-3-5-11(6-4-10)14(21)22-2/h8,10-11H,3-7H2,1-2H3 |
| InChIKey | DILWQQMHYKJRPP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |