C17H24N2 — CID 172585384
3-N-[(1Z)-buta-1,3-dienyl]-1-cyclopropyl-2-ethylidene-1-N-[(Z)-prop-1-enyl]pentane-1,3-diimine (PubChem CID 172585384) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 3-N-[(1Z)-buta-1,3-dienyl]-1-cyclopropyl-2-ethylidene-1-N-[(Z)-prop-1-enyl]pentane-1,3-diimine.
| Compound Name | 3-N-[(1Z)-buta-1,3-dienyl]-1-cyclopropyl-2-ethylidene-1-N-[(Z)-prop-1-enyl]pentane-1,3-diimine |
|---|---|
| PubChem CID | 172585384 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 3-N-[(1Z)-buta-1,3-dienyl]-1-cyclopropyl-2-ethylidene-1-N-[(Z)-prop-1-enyl]pentane-1,3-diimine |
| SMILES | C=C/C=C\N=C(/CC)C(=CC)/C(=N/C=C\C)C1CC1 |
| InChI | InChI=1S/C17H24N2/c1-5-9-13-18-16(8-4)15(7-3)17(14-10-11-14)19-12-6-2/h5-7,9,12-14H,1,8,10-11H2,2-4H3/b12-6-,13-9-,15-7?,18-16+,19-17+ |
| InChIKey | CYCNUCWRVYLPJM-ZFOIZFEWSA-N |
| XLogP | 4.87 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|