C19H17BO2S — CID 172588415
2-[2-(8-ethynylnaphthalen-1-yl)-4,5,5-trimethyl-1,3,2-dioxaborolan-4-yl]ethenethione (PubChem CID 172588415) has the molecular formula C19H17BO2S and a molecular weight of 320.22 g/mol. Its IUPAC name is 2-[2-(8-ethynylnaphthalen-1-yl)-4,5,5-trimethyl-1,3,2-dioxaborolan-4-yl]ethenethione.
| Compound Name | 2-[2-(8-ethynylnaphthalen-1-yl)-4,5,5-trimethyl-1,3,2-dioxaborolan-4-yl]ethenethione |
|---|---|
| PubChem CID | 172588415 |
| Molecular Formula | C19H17BO2S |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 2-[2-(8-ethynylnaphthalen-1-yl)-4,5,5-trimethyl-1,3,2-dioxaborolan-4-yl]ethenethione |
| SMILES | C#Cc1cccc2cccc(B3OC(C)(C)C(C)(C=C=S)O3)c12 |
| InChI | InChI=1S/C19H17BO2S/c1-5-14-8-6-9-15-10-7-11-16(17(14)15)20-21-18(2,3)19(4,22-20)12-13-23/h1,6-12H,2-4H3 |
| InChIKey | QMWKNZPTLSVAQB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|