C26H30B2O4 — CID 169049993
4,4,5,5-tetramethyl-2-[2-[8-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethynyl]naphthalen-1-yl]ethynyl]-1,3,2-dioxaborolane (PubChem CID 169049993) has the molecular formula C26H30B2O4 and a molecular weight of 428.15 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[2-[8-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethynyl]naphthalen-1-yl]ethynyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[2-[8-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethynyl]naphthalen-1-yl]ethynyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 169049993 |
| Molecular Formula | C26H30B2O4 |
| Molecular Weight | 428.15 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[2-[8-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethynyl]naphthalen-1-yl]ethynyl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C#Cc2cccc3cccc(C#CB4OC(C)(C)C(C)(C)O4)c23)OC1(C)C |
| InChI | InChI=1S/C26H30B2O4/c1-23(2)24(3,4)30-27(29-23)17-15-20-13-9-11-19-12-10-14-21(22(19)20)16-18-28-31-25(5,6)26(7,8)32-28/h9-14H,1-8H3 |
| InChIKey | ZYSXYPHYTRWRCR-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.15 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|