C15H22ClN5O — CID 172590692
1-[4-[(5-chloro-4-pyrrolidin-3-ylpyrimidin-2-yl)amino]piperidin-1-yl]ethanone (PubChem CID 172590692) has the molecular formula C15H22ClN5O and a molecular weight of 323.83 g/mol. Its IUPAC name is 1-[4-[(5-chloro-4-pyrrolidin-3-ylpyrimidin-2-yl)amino]piperidin-1-yl]ethanone.
| Compound Name | 1-[4-[(5-chloro-4-pyrrolidin-3-ylpyrimidin-2-yl)amino]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 172590692 |
| Molecular Formula | C15H22ClN5O |
| Molecular Weight | 323.83 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 1-[4-[(5-chloro-4-pyrrolidin-3-ylpyrimidin-2-yl)amino]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(Nc2ncc(Cl)c(C3CCNC3)n2)CC1 |
| InChI | InChI=1S/C15H22ClN5O/c1-10(22)21-6-3-12(4-7-21)19-15-18-9-13(16)14(20-15)11-2-5-17-8-11/h9,11-12,17H,2-8H2,1H3,(H,18,19,20) |
| InChIKey | BIBCRRJHVANHQK-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.83 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |