C27H23N3O6 — CID 17259510
N-(4-acetylphenyl)-N-[(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)methyl]-2-nitrobenzamide (PubChem CID 17259510) has the molecular formula C27H23N3O6 and a molecular weight of 485.50 g/mol. Its IUPAC name is N-(4-acetylphenyl)-N-[(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)methyl]-2-nitrobenzamide.
| Compound Name | N-(4-acetylphenyl)-N-[(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)methyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 17259510 |
| Molecular Formula | C27H23N3O6 |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | N-(4-acetylphenyl)-N-[(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)methyl]-2-nitrobenzamide |
| SMILES | CC(=O)c1ccc(N(CN2C(=O)C3C4C=CC(C5CC45)C3C2=O)C(=O)c2ccccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H23N3O6/c1-14(31)15-6-8-16(9-7-15)28(25(32)19-4-2-3-5-22(19)30(35)36)13-29-26(33)23-17-10-11-18(21-12-20(17)21)24(23)27(29)34/h2-11,17-18,20-21,23-24H,12-13H2,1H3 |
| InChIKey | HWLRAWHMQXVCMX-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 117.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|