C27H24BrN3O5 — CID 19646544
N-(4-bromo-3,5-dimethylphenyl)-N-[(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)methyl]-2-nitrobenzamide (PubChem CID 19646544) has the molecular formula C27H24BrN3O5 and a molecular weight of 550.41 g/mol. Its IUPAC name is N-(4-bromo-3,5-dimethylphenyl)-N-[(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)methyl]-2-nitrobenzamide.
| Compound Name | N-(4-bromo-3,5-dimethylphenyl)-N-[(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)methyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 19646544 |
| Molecular Formula | C27H24BrN3O5 |
| Molecular Weight | 550.41 g/mol |
| Exact Mass | 549.09 |
| IUPAC Name | N-(4-bromo-3,5-dimethylphenyl)-N-[(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)methyl]-2-nitrobenzamide |
| SMILES | Cc1cc(N(CN2C(=O)C3C4C=CC(C5CC45)C3C2=O)C(=O)c2ccccc2[N+](=O)[O-])cc(C)c1Br |
| InChI | InChI=1S/C27H24BrN3O5/c1-13-9-15(10-14(2)24(13)28)29(25(32)18-5-3-4-6-21(18)31(35)36)12-30-26(33)22-16-7-8-17(20-11-19(16)20)23(22)27(30)34/h3-10,16-17,19-20,22-23H,11-12H2,1-2H3 |
| InChIKey | BXHXQPKSZQSVGH-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.41 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|