C17H22F3NO2 — CID 172595523
(2E,3E,5Z)-1-(4-butanoylpiperidin-1-yl)-2-ethylidene-4,5,6-trifluorohexa-3,5-dien-1-one (PubChem CID 172595523) has the molecular formula C17H22F3NO2 and a molecular weight of 329.36 g/mol. Its IUPAC name is (2E,3E,5Z)-1-(4-butanoylpiperidin-1-yl)-2-ethylidene-4,5,6-trifluorohexa-3,5-dien-1-one.
| Compound Name | (2E,3E,5Z)-1-(4-butanoylpiperidin-1-yl)-2-ethylidene-4,5,6-trifluorohexa-3,5-dien-1-one |
|---|---|
| PubChem CID | 172595523 |
| Molecular Formula | C17H22F3NO2 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | (2E,3E,5Z)-1-(4-butanoylpiperidin-1-yl)-2-ethylidene-4,5,6-trifluorohexa-3,5-dien-1-one |
| SMILES | C/C=C(\C=C(F)/C(F)=C/F)C(=O)N1CCC(C(=O)CCC)CC1 |
| InChI | InChI=1S/C17H22F3NO2/c1-3-5-16(22)13-6-8-21(9-7-13)17(23)12(4-2)10-14(19)15(20)11-18/h4,10-11,13H,3,5-9H2,1-2H3/b12-4+,14-10+,15-11- |
| InChIKey | UWEKKVNMRHJNGG-GHYUZSJISA-N |
| XLogP | 4.17 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|