About N-ethyl-N-methylethanamine;S-[2-(2-formyl-4-methoxyphenyl)-5-methoxyphenyl] N,N-dimethylcarbamothioate
N-ethyl-N-methylethanamine;S-[2-(2-formyl-4-methoxyphenyl)-5-methoxyphenyl] N,N-dimethylcarbamothioate (PubChem CID 172595876) has the molecular formula C23H32N2O4S
and a molecular weight of 432.59 g/mol. Its IUPAC name is N-ethyl-N-methylethanamine;S-[2-(2-formyl-4-methoxyphenyl)-5-methoxyphenyl] N,N-dimethylcarbamothioate.
Molecular Properties
| Compound Name | N-ethyl-N-methylethanamine;S-[2-(2-formyl-4-methoxyphenyl)-5-methoxyphenyl] N,N-dimethylcarbamothioate |
| PubChem CID | 172595876 |
| Molecular Formula | C23H32N2O4S |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | N-ethyl-N-methylethanamine;S-[2-(2-formyl-4-methoxyphenyl)-5-methoxyphenyl] N,N-dimethylcarbamothioate |
| SMILES | CCN(C)CC.COc1ccc(-c2ccc(OC)cc2SC(=O)N(C)C)c(C=O)c1 |
| InChI | InChI=1S/C18H19NO4S.C5H13N/c1-19(2)18(21)24-17-10-14(23-4)6-8-16(17)15-7-5-13(22-3)9-12(15)11-20;1-4-6(3)5-2/h5-11H,1-4H3;4-5H2,1-3H3 |
| InChIKey | CNWGDFAKQILBBR-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N-methylethanamine;S-[2-(2-formyl-4-methoxyphenyl)-5-methoxyphenyl] N,N-dimethylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-methylethanamine;S-[2-(2-formyl-4-methoxyphenyl)-5-methoxyphenyl] N,N-dimethylcarbamothioate?
The IUPAC name of N-ethyl-N-methylethanamine;S-[2-(2-formyl-4-methoxyphenyl)-5-methoxyphenyl] N,N-dimethylcarbamothioate (CID 172595876) is N-ethyl-N-methylethanamine;S-[2-(2-formyl-4-methoxyphenyl)-5-methoxyphenyl] N,N-dimethylcarbamothioate.
What is the SMILES notation for N-ethyl-N-methylethanamine;S-[2-(2-formyl-4-methoxyphenyl)-5-methoxyphenyl] N,N-dimethylcarbamothioate?
The canonical SMILES for N-ethyl-N-methylethanamine;S-[2-(2-formyl-4-methoxyphenyl)-5-methoxyphenyl] N,N-dimethylcarbamothioate is CCN(C)CC.COc1ccc(-c2ccc(OC)cc2SC(=O)N(C)C)c(C=O)c1.
What is the InChIKey of N-ethyl-N-methylethanamine;S-[2-(2-formyl-4-methoxyphenyl)-5-methoxyphenyl] N,N-dimethylcarbamothioate?
The InChIKey is CNWGDFAKQILBBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO4S.C5H13N/c1-19(2)18(21)24-17-10-14(23-4)6-8-16(17)15-7-5-13(22-3)9-12(15)11-20;1-4-6(3)5-2/h5-11H,1-4H3;4-5H2,1-3H3.
What are the key properties of N-ethyl-N-methylethanamine;S-[2-(2-formyl-4-methoxyphenyl)-5-methoxyphenyl] N,N-dimethylcarbamothioate?
N-ethyl-N-methylethanamine;S-[2-(2-formyl-4-methoxyphenyl)-5-methoxyphenyl] N,N-dimethylcarbamothioate has a molecular weight of 432.59 g/mol, XLogP of 4.91, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-methylethanamine;S-[2-(2-formyl-4-methoxyphenyl)-5-methoxyphenyl] N,N-dimethylcarbamothioate is sourced from PubChem (CID 172595876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).