C23H32N2O4S — CID 170746250
N,N-diethyl-5-methoxy-2-(4-methoxy-2-methylsulfanylphenyl)benzamide;N,N-dimethylformamide (PubChem CID 170746250) has the molecular formula C23H32N2O4S and a molecular weight of 432.59 g/mol. Its IUPAC name is N,N-diethyl-5-methoxy-2-(4-methoxy-2-methylsulfanylphenyl)benzamide;N,N-dimethylformamide.
| Compound Name | N,N-diethyl-5-methoxy-2-(4-methoxy-2-methylsulfanylphenyl)benzamide;N,N-dimethylformamide |
|---|---|
| PubChem CID | 170746250 |
| Molecular Formula | C23H32N2O4S |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | N,N-diethyl-5-methoxy-2-(4-methoxy-2-methylsulfanylphenyl)benzamide;N,N-dimethylformamide |
| SMILES | CCN(CC)C(=O)c1cc(OC)ccc1-c1ccc(OC)cc1SC.CN(C)C=O |
| InChI | InChI=1S/C20H25NO3S.C3H7NO/c1-6-21(7-2)20(22)18-12-14(23-3)8-10-16(18)17-11-9-15(24-4)13-19(17)25-5;1-4(2)3-5/h8-13H,6-7H2,1-5H3;3H,1-2H3 |
| InChIKey | GGDCNMBIZCEISR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|