C18H19NO4S — CID 20792740
S-[5-methoxy-2-(3-methoxybenzoyl)phenyl] N,N-dimethylcarbamothioate (PubChem CID 20792740) has the molecular formula C18H19NO4S and a molecular weight of 345.42 g/mol. Its IUPAC name is S-[5-methoxy-2-(3-methoxybenzoyl)phenyl] N,N-dimethylcarbamothioate.
| Compound Name | S-[5-methoxy-2-(3-methoxybenzoyl)phenyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 20792740 |
| Molecular Formula | C18H19NO4S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | S-[5-methoxy-2-(3-methoxybenzoyl)phenyl] N,N-dimethylcarbamothioate |
| SMILES | COc1cccc(C(=O)c2ccc(OC)cc2SC(=O)N(C)C)c1 |
| InChI | InChI=1S/C18H19NO4S/c1-19(2)18(21)24-16-11-14(23-4)8-9-15(16)17(20)12-6-5-7-13(10-12)22-3/h5-11H,1-4H3 |
| InChIKey | PLKWEFJEHPTEPH-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|