C20H27ClN4O — CID 172596121
1-[(5Z)-6-butan-2-ylimino-2-chloro-5-ethylidenequinazolin-4-yl]-3-methylpiperidin-3-ol (PubChem CID 172596121) has the molecular formula C20H27ClN4O and a molecular weight of 374.92 g/mol. Its IUPAC name is 1-[(5Z)-6-butan-2-ylimino-2-chloro-5-ethylidenequinazolin-4-yl]-3-methylpiperidin-3-ol.
| Compound Name | 1-[(5Z)-6-butan-2-ylimino-2-chloro-5-ethylidenequinazolin-4-yl]-3-methylpiperidin-3-ol |
|---|---|
| PubChem CID | 172596121 |
| Molecular Formula | C20H27ClN4O |
| Molecular Weight | 374.92 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 1-[(5Z)-6-butan-2-ylimino-2-chloro-5-ethylidenequinazolin-4-yl]-3-methylpiperidin-3-ol |
| SMILES | C/C=C1C(=N\C(C)CC)\C=Cc2nc(Cl)nc(N3CCCC(C)(O)C3)c2\1 |
| InChI | InChI=1S/C20H27ClN4O/c1-5-13(3)22-15-8-9-16-17(14(15)6-2)18(24-19(21)23-16)25-11-7-10-20(4,26)12-25/h6,8-9,13,26H,5,7,10-12H2,1-4H3/b14-6+,22-15+ |
| InChIKey | DDMMAQNNOUSNBC-MLUQCUIJSA-N |
| XLogP | 4.15 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.92 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|