C21H30N4O2 — CID 172596579
4-[(5Z)-6-butan-2-ylimino-5-ethylidene-2-methylquinazolin-4-yl]-6-methyl-1,4-oxazepan-6-ol (PubChem CID 172596579) has the molecular formula C21H30N4O2 and a molecular weight of 370.50 g/mol. Its IUPAC name is 4-[(5Z)-6-butan-2-ylimino-5-ethylidene-2-methylquinazolin-4-yl]-6-methyl-1,4-oxazepan-6-ol.
| Compound Name | 4-[(5Z)-6-butan-2-ylimino-5-ethylidene-2-methylquinazolin-4-yl]-6-methyl-1,4-oxazepan-6-ol |
|---|---|
| PubChem CID | 172596579 |
| Molecular Formula | C21H30N4O2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | 4-[(5Z)-6-butan-2-ylimino-5-ethylidene-2-methylquinazolin-4-yl]-6-methyl-1,4-oxazepan-6-ol |
| SMILES | C/C=C1C(=N\C(C)CC)\C=Cc2nc(C)nc(N3CCOCC(C)(O)C3)c2\1 |
| InChI | InChI=1S/C21H30N4O2/c1-6-14(3)22-17-8-9-18-19(16(17)7-2)20(24-15(4)23-18)25-10-11-27-13-21(5,26)12-25/h7-9,14,26H,6,10-13H2,1-5H3/b16-7+,22-17+ |
| InChIKey | KNBXDDKQGRPKNI-XTPHKEJTSA-N |
| XLogP | 3.04 |
| TPSA | 70.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|