C21H30BrN5O2 — CID 172596116
[4-[(5Z)-7-bromo-6-butan-2-ylimino-2-(ethylamino)-5-ethylidenequinazolin-4-yl]morpholin-2-yl]methanol (PubChem CID 172596116) has the molecular formula C21H30BrN5O2 and a molecular weight of 464.41 g/mol. Its IUPAC name is [4-[(5Z)-7-bromo-6-butan-2-ylimino-2-(ethylamino)-5-ethylidenequinazolin-4-yl]morpholin-2-yl]methanol.
| Compound Name | [4-[(5Z)-7-bromo-6-butan-2-ylimino-2-(ethylamino)-5-ethylidenequinazolin-4-yl]morpholin-2-yl]methanol |
|---|---|
| PubChem CID | 172596116 |
| Molecular Formula | C21H30BrN5O2 |
| Molecular Weight | 464.41 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | [4-[(5Z)-7-bromo-6-butan-2-ylimino-2-(ethylamino)-5-ethylidenequinazolin-4-yl]morpholin-2-yl]methanol |
| SMILES | C/C=C1C(=N\C(C)CC)\C(Br)=Cc2nc(NCC)nc(N3CCOC(CO)C3)c2\1 |
| InChI | InChI=1S/C21H30BrN5O2/c1-5-13(4)24-19-15(6-2)18-17(10-16(19)22)25-21(23-7-3)26-20(18)27-8-9-29-14(11-27)12-28/h6,10,13-14,28H,5,7-9,11-12H2,1-4H3,(H,23,25,26)/b15-6-,24-19- |
| InChIKey | XGMSQCBHPQWPLG-YOGZHUKBSA-N |
| XLogP | 3.50 |
| TPSA | 82.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|