C32H51BrN4O3 — CID 172596600
[4-[(5Z)-7-bromo-6-butan-2-ylimino-2-(2-butyl-2-methyloctoxy)-5-ethylidenequinazolin-4-yl]morpholin-2-yl]methanol (PubChem CID 172596600) has the molecular formula C32H51BrN4O3 and a molecular weight of 619.69 g/mol. Its IUPAC name is [4-[(5Z)-7-bromo-6-butan-2-ylimino-2-(2-butyl-2-methyloctoxy)-5-ethylidenequinazolin-4-yl]morpholin-2-yl]methanol.
| Compound Name | [4-[(5Z)-7-bromo-6-butan-2-ylimino-2-(2-butyl-2-methyloctoxy)-5-ethylidenequinazolin-4-yl]morpholin-2-yl]methanol |
|---|---|
| PubChem CID | 172596600 |
| Molecular Formula | C32H51BrN4O3 |
| Molecular Weight | 619.69 g/mol |
| Exact Mass | 618.31 |
| IUPAC Name | [4-[(5Z)-7-bromo-6-butan-2-ylimino-2-(2-butyl-2-methyloctoxy)-5-ethylidenequinazolin-4-yl]morpholin-2-yl]methanol |
| SMILES | C/C=C1C(=N\C(C)CC)\C(Br)=Cc2nc(OCC(C)(CCCC)CCCCCC)nc(N3CCOC(CO)C3)c2\1 |
| InChI | InChI=1S/C32H51BrN4O3/c1-7-11-13-14-16-32(6,15-12-8-2)22-40-31-35-27-19-26(33)29(34-23(5)9-3)25(10-4)28(27)30(36-31)37-17-18-39-24(20-37)21-38/h10,19,23-24,38H,7-9,11-18,20-22H2,1-6H3/b25-10-,34-29- |
| InChIKey | VRARAHDTNCHJBX-XOWOVBNESA-N |
| XLogP | 7.61 |
| TPSA | 80.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.69 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|