C20H26BrClN4O — CID 172596457
1-[(5Z)-7-bromo-6-butan-2-ylimino-2-chloro-5-ethylidenequinazolin-4-yl]azepan-4-ol (PubChem CID 172596457) has the molecular formula C20H26BrClN4O and a molecular weight of 453.81 g/mol. Its IUPAC name is 1-[(5Z)-7-bromo-6-butan-2-ylimino-2-chloro-5-ethylidenequinazolin-4-yl]azepan-4-ol.
| Compound Name | 1-[(5Z)-7-bromo-6-butan-2-ylimino-2-chloro-5-ethylidenequinazolin-4-yl]azepan-4-ol |
|---|---|
| PubChem CID | 172596457 |
| Molecular Formula | C20H26BrClN4O |
| Molecular Weight | 453.81 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | 1-[(5Z)-7-bromo-6-butan-2-ylimino-2-chloro-5-ethylidenequinazolin-4-yl]azepan-4-ol |
| SMILES | C/C=C1C(=N\C(C)CC)\C(Br)=Cc2nc(Cl)nc(N3CCCC(O)CC3)c2\1 |
| InChI | InChI=1S/C20H26BrClN4O/c1-4-12(3)23-18-14(5-2)17-16(11-15(18)21)24-20(22)25-19(17)26-9-6-7-13(27)8-10-26/h5,11-13,27H,4,6-10H2,1-3H3/b14-5-,23-18- |
| InChIKey | NTSJFPKFNFDIMA-XGTMCLQUSA-N |
| XLogP | 4.87 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.81 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|