C33H53BrN4O2 — CID 172596496
1-[(5Z)-7-bromo-6-butan-2-ylimino-2-(2-butyl-2-methylheptoxy)-5-ethylidenequinazolin-4-yl]-4-methylazepan-4-ol (PubChem CID 172596496) has the molecular formula C33H53BrN4O2 and a molecular weight of 617.72 g/mol. Its IUPAC name is 1-[(5Z)-7-bromo-6-butan-2-ylimino-2-(2-butyl-2-methylheptoxy)-5-ethylidenequinazolin-4-yl]-4-methylazepan-4-ol.
| Compound Name | 1-[(5Z)-7-bromo-6-butan-2-ylimino-2-(2-butyl-2-methylheptoxy)-5-ethylidenequinazolin-4-yl]-4-methylazepan-4-ol |
|---|---|
| PubChem CID | 172596496 |
| Molecular Formula | C33H53BrN4O2 |
| Molecular Weight | 617.72 g/mol |
| Exact Mass | 616.34 |
| IUPAC Name | 1-[(5Z)-7-bromo-6-butan-2-ylimino-2-(2-butyl-2-methylheptoxy)-5-ethylidenequinazolin-4-yl]-4-methylazepan-4-ol |
| SMILES | C/C=C1C(=N\C(C)CC)\C(Br)=Cc2nc(OCC(C)(CCCC)CCCCC)nc(N3CCCC(C)(O)CC3)c2\1 |
| InChI | InChI=1S/C33H53BrN4O2/c1-8-12-14-17-32(6,16-13-9-2)23-40-31-36-27-22-26(34)29(35-24(5)10-3)25(11-4)28(27)30(37-31)38-20-15-18-33(7,39)19-21-38/h11,22,24,39H,8-10,12-21,23H2,1-7H3/b25-11-,35-29- |
| InChIKey | JWVKUJVXSJHBHG-PZVUHDEXSA-N |
| XLogP | 8.77 |
| TPSA | 70.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.72 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|