C21H31N4OPS — CID 172596137
1-[(5Z)-6-butan-2-ylimino-5-ethylidene-2-ethylsulfanyl-8-phosphanylquinazolin-4-yl]piperidin-4-ol (PubChem CID 172596137) has the molecular formula C21H31N4OPS and a molecular weight of 418.55 g/mol. Its IUPAC name is 1-[(5Z)-6-butan-2-ylimino-5-ethylidene-2-ethylsulfanyl-8-phosphanylquinazolin-4-yl]piperidin-4-ol.
| Compound Name | 1-[(5Z)-6-butan-2-ylimino-5-ethylidene-2-ethylsulfanyl-8-phosphanylquinazolin-4-yl]piperidin-4-ol |
|---|---|
| PubChem CID | 172596137 |
| Molecular Formula | C21H31N4OPS |
| Molecular Weight | 418.55 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 1-[(5Z)-6-butan-2-ylimino-5-ethylidene-2-ethylsulfanyl-8-phosphanylquinazolin-4-yl]piperidin-4-ol |
| SMILES | C/C=C1C(=N\C(C)CC)\C=C(P)c2nc(SCC)nc(N3CCC(O)CC3)c2\1 |
| InChI | InChI=1S/C21H31N4OPS/c1-5-13(4)22-16-12-17(27)19-18(15(16)6-2)20(24-21(23-19)28-7-3)25-10-8-14(26)9-11-25/h6,12-14,26H,5,7-11,27H2,1-4H3/b15-6+,22-16+ |
| InChIKey | KYHWCUOWZNUZBO-XYRWWDFDSA-N |
| XLogP | 4.42 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.55 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|