C21H28BrFN4OS — CID 172596279
1-[(5Z)-7-bromo-6-butan-2-ylimino-5-ethylidene-2-ethylsulfanyl-8-fluoroquinazolin-4-yl]piperidin-3-ol (PubChem CID 172596279) has the molecular formula C21H28BrFN4OS and a molecular weight of 483.45 g/mol. Its IUPAC name is 1-[(5Z)-7-bromo-6-butan-2-ylimino-5-ethylidene-2-ethylsulfanyl-8-fluoroquinazolin-4-yl]piperidin-3-ol.
| Compound Name | 1-[(5Z)-7-bromo-6-butan-2-ylimino-5-ethylidene-2-ethylsulfanyl-8-fluoroquinazolin-4-yl]piperidin-3-ol |
|---|---|
| PubChem CID | 172596279 |
| Molecular Formula | C21H28BrFN4OS |
| Molecular Weight | 483.45 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | 1-[(5Z)-7-bromo-6-butan-2-ylimino-5-ethylidene-2-ethylsulfanyl-8-fluoroquinazolin-4-yl]piperidin-3-ol |
| SMILES | C/C=C1C(=N\C(C)CC)\C(Br)=C(F)c2nc(SCC)nc(N3CCCC(O)C3)c2\1 |
| InChI | InChI=1S/C21H28BrFN4OS/c1-5-12(4)24-18-14(6-2)15-19(17(23)16(18)22)25-21(29-7-3)26-20(15)27-10-8-9-13(28)11-27/h6,12-13,28H,5,7-11H2,1-4H3/b14-6-,24-18- |
| InChIKey | CCLGRHKLVZXYQI-MJKZGTACSA-N |
| XLogP | 5.24 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.45 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|