C21H29BrN4OS3 — CID 172596293
1-[6-bromo-3-[ethyl-bis(sulfanyl)-λ4-sulfanyl]-5,8,9-trimethyl-8,9-dihydropyrido[3,2-f]quinazolin-1-yl]piperidin-3-ol (PubChem CID 172596293) has the molecular formula C21H29BrN4OS3 and a molecular weight of 529.60 g/mol. Its IUPAC name is 1-[6-bromo-3-[ethyl-bis(sulfanyl)-λ4-sulfanyl]-5,8,9-trimethyl-8,9-dihydropyrido[3,2-f]quinazolin-1-yl]piperidin-3-ol.
| Compound Name | 1-[6-bromo-3-[ethyl-bis(sulfanyl)-λ4-sulfanyl]-5,8,9-trimethyl-8,9-dihydropyrido[3,2-f]quinazolin-1-yl]piperidin-3-ol |
|---|---|
| PubChem CID | 172596293 |
| Molecular Formula | C21H29BrN4OS3 |
| Molecular Weight | 529.60 g/mol |
| Exact Mass | 528.07 |
| IUPAC Name | 1-[6-bromo-3-[ethyl-bis(sulfanyl)-λ4-sulfanyl]-5,8,9-trimethyl-8,9-dihydropyrido[3,2-f]quinazolin-1-yl]piperidin-3-ol |
| SMILES | CCS(S)(S)c1nc(N2CCCC(O)C2)c2c3c(c(Br)c(C)c2n1)=NC(C)C(C)C=3 |
| InChI | InChI=1S/C21H29BrN4OS3/c1-5-30(28,29)21-24-18-12(3)17(22)19-15(9-11(2)13(4)23-19)16(18)20(25-21)26-8-6-7-14(27)10-26/h9,11,13-14,27-29H,5-8,10H2,1-4H3 |
| InChIKey | CTGGZRNMVHRBDL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.60 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|