C36H58BrN5O3 — CID 172596229
tert-butyl 4-[(5Z)-7-bromo-6-butan-2-ylimino-2-(2-butyl-2-methyloctoxy)-5-ethylidenequinazolin-4-yl]piperazine-1-carboxylate (PubChem CID 172596229) has the molecular formula C36H58BrN5O3 and a molecular weight of 688.80 g/mol. Its IUPAC name is tert-butyl 4-[(5Z)-7-bromo-6-butan-2-ylimino-2-(2-butyl-2-methyloctoxy)-5-ethylidenequinazolin-4-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(5Z)-7-bromo-6-butan-2-ylimino-2-(2-butyl-2-methyloctoxy)-5-ethylidenequinazolin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 172596229 |
| Molecular Formula | C36H58BrN5O3 |
| Molecular Weight | 688.80 g/mol |
| Exact Mass | 687.37 |
| IUPAC Name | tert-butyl 4-[(5Z)-7-bromo-6-butan-2-ylimino-2-(2-butyl-2-methyloctoxy)-5-ethylidenequinazolin-4-yl]piperazine-1-carboxylate |
| SMILES | C/C=C1C(=N\C(C)CC)\C(Br)=Cc2nc(OCC(C)(CCCC)CCCCCC)nc(N3CCN(C(=O)OC(C)(C)C)CC3)c2\1 |
| InChI | InChI=1S/C36H58BrN5O3/c1-10-14-16-17-19-36(9,18-15-11-2)25-44-33-39-29-24-28(37)31(38-26(5)12-3)27(13-4)30(29)32(40-33)41-20-22-42(23-21-41)34(43)45-35(6,7)8/h13,24,26H,10-12,14-23,25H2,1-9H3/b27-13-,38-31- |
| InChIKey | GKXLNCYJEFCYDD-SWXBNRQRSA-N |
| XLogP | 9.47 |
| TPSA | 80.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.80 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|