C29H44BrN5O2 — CID 172596254
(5Z)-7-bromo-N-butan-2-yl-5-ethylidene-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-(1,4-oxazepan-4-yl)quinazolin-6-imine;ethane (PubChem CID 172596254) has the molecular formula C29H44BrN5O2 and a molecular weight of 574.61 g/mol. Its IUPAC name is (5Z)-7-bromo-N-butan-2-yl-5-ethylidene-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-(1,4-oxazepan-4-yl)quinazolin-6-imine;ethane.
| Compound Name | (5Z)-7-bromo-N-butan-2-yl-5-ethylidene-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-(1,4-oxazepan-4-yl)quinazolin-6-imine;ethane |
|---|---|
| PubChem CID | 172596254 |
| Molecular Formula | C29H44BrN5O2 |
| Molecular Weight | 574.61 g/mol |
| Exact Mass | 573.27 |
| IUPAC Name | (5Z)-7-bromo-N-butan-2-yl-5-ethylidene-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-(1,4-oxazepan-4-yl)quinazolin-6-imine;ethane |
| SMILES | C/C=C1C(=N\C(C)CC)\C(Br)=Cc2nc(OCC34CCCN3CCC4)nc(N3CCCOCC3)c2\1.CC |
| InChI | InChI=1S/C27H38BrN5O2.C2H6/c1-4-19(3)29-24-20(5-2)23-22(17-21(24)28)30-26(31-25(23)32-11-8-15-34-16-14-32)35-18-27-9-6-12-33(27)13-7-10-27;1-2/h5,17,19H,4,6-16,18H2,1-3H3;1-2H3/b20-5-,29-24-; |
| InChIKey | JOHGVTBZYUIRRB-YBHRTVGTSA-N |
| XLogP | 6.13 |
| TPSA | 63.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.61 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|