C32H53BrN4O2S — CID 172596260
(5Z)-7-bromo-N-butan-2-yl-2-(2-butyl-2-methyloctoxy)-5-ethylidene-4-(1,4-oxazepan-4-yl)quinazolin-6-imine;sulfane (PubChem CID 172596260) has the molecular formula C32H53BrN4O2S and a molecular weight of 637.77 g/mol. Its IUPAC name is (5Z)-7-bromo-N-butan-2-yl-2-(2-butyl-2-methyloctoxy)-5-ethylidene-4-(1,4-oxazepan-4-yl)quinazolin-6-imine;sulfane.
| Compound Name | (5Z)-7-bromo-N-butan-2-yl-2-(2-butyl-2-methyloctoxy)-5-ethylidene-4-(1,4-oxazepan-4-yl)quinazolin-6-imine;sulfane |
|---|---|
| PubChem CID | 172596260 |
| Molecular Formula | C32H53BrN4O2S |
| Molecular Weight | 637.77 g/mol |
| Exact Mass | 636.31 |
| IUPAC Name | (5Z)-7-bromo-N-butan-2-yl-2-(2-butyl-2-methyloctoxy)-5-ethylidene-4-(1,4-oxazepan-4-yl)quinazolin-6-imine;sulfane |
| SMILES | C/C=C1C(=N\C(C)CC)\C(Br)=Cc2nc(OCC(C)(CCCC)CCCCCC)nc(N3CCCOCC3)c2\1.S |
| InChI | InChI=1S/C32H51BrN4O2.H2S/c1-7-11-13-14-17-32(6,16-12-8-2)23-39-31-35-27-22-26(33)29(34-24(5)9-3)25(10-4)28(27)30(36-31)37-18-15-20-38-21-19-37;/h10,22,24H,7-9,11-21,23H2,1-6H3;1H2/b25-10-,34-29-; |
| InChIKey | GXKQEYZUYCFGOW-CVMBCCODSA-N |
| XLogP | 8.75 |
| TPSA | 59.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.77 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|