C33H53BrN4O3 — CID 172596405
4-[(5Z)-7-bromo-6-butan-2-ylimino-2-(2-butyl-2-methylheptoxy)-5-ethylidene-8-methylquinazolin-4-yl]-6-methyl-1,4-oxazepan-6-ol (PubChem CID 172596405) has the molecular formula C33H53BrN4O3 and a molecular weight of 633.72 g/mol. Its IUPAC name is 4-[(5Z)-7-bromo-6-butan-2-ylimino-2-(2-butyl-2-methylheptoxy)-5-ethylidene-8-methylquinazolin-4-yl]-6-methyl-1,4-oxazepan-6-ol.
| Compound Name | 4-[(5Z)-7-bromo-6-butan-2-ylimino-2-(2-butyl-2-methylheptoxy)-5-ethylidene-8-methylquinazolin-4-yl]-6-methyl-1,4-oxazepan-6-ol |
|---|---|
| PubChem CID | 172596405 |
| Molecular Formula | C33H53BrN4O3 |
| Molecular Weight | 633.72 g/mol |
| Exact Mass | 632.33 |
| IUPAC Name | 4-[(5Z)-7-bromo-6-butan-2-ylimino-2-(2-butyl-2-methylheptoxy)-5-ethylidene-8-methylquinazolin-4-yl]-6-methyl-1,4-oxazepan-6-ol |
| SMILES | C/C=C1C(=N\C(C)CC)\C(Br)=C(C)c2nc(OCC(C)(CCCC)CCCCC)nc(N3CCOCC(C)(O)C3)c2\1 |
| InChI | InChI=1S/C33H53BrN4O3/c1-9-13-15-17-32(7,16-14-10-2)21-41-31-36-28-24(6)27(34)29(35-23(5)11-3)25(12-4)26(28)30(37-31)38-18-19-40-22-33(8,39)20-38/h12,23,39H,9-11,13-22H2,1-8H3/b25-12-,35-29- |
| InChIKey | VNHYAIKIKIMSJK-MSPGXUFJSA-N |
| XLogP | 8.00 |
| TPSA | 80.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.72 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|