C17H20BrCl2F2N3 — CID 172596607
(5Z)-7-bromo-2,4-dichloro-5-ethylidenequinazolin-6-imine;2,2-difluoro-4-methylhexane (PubChem CID 172596607) has the molecular formula C17H20BrCl2F2N3 and a molecular weight of 455.17 g/mol. Its IUPAC name is (5Z)-7-bromo-2,4-dichloro-5-ethylidenequinazolin-6-imine;2,2-difluoro-4-methylhexane.
| Compound Name | (5Z)-7-bromo-2,4-dichloro-5-ethylidenequinazolin-6-imine;2,2-difluoro-4-methylhexane |
|---|---|
| PubChem CID | 172596607 |
| Molecular Formula | C17H20BrCl2F2N3 |
| Molecular Weight | 455.17 g/mol |
| Exact Mass | 453.02 |
| IUPAC Name | (5Z)-7-bromo-2,4-dichloro-5-ethylidenequinazolin-6-imine;2,2-difluoro-4-methylhexane |
| SMILES | CCC(C)CC(C)(F)F.[H]/N=C1\C(Br)=Cc2nc(Cl)nc(Cl)c2\C1=C\C |
| InChI | InChI=1S/C10H6BrCl2N3.C7H14F2/c1-2-4-7-6(3-5(11)8(4)14)15-10(13)16-9(7)12;1-4-6(2)5-7(3,8)9/h2-3,14H,1H3;6H,4-5H2,1-3H3/b4-2-,14-8-; |
| InChIKey | AUTRWOJXMKHOGX-YBDFZJMRSA-N |
| XLogP | 7.03 |
| TPSA | 49.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.17 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|