C16H19BrClN3S — CID 172596225
(5Z)-7-bromo-N-butan-2-yl-4-chloro-5-ethylidene-2-ethylsulfanylquinazolin-6-imine (PubChem CID 172596225) has the molecular formula C16H19BrClN3S and a molecular weight of 400.77 g/mol. Its IUPAC name is (5Z)-7-bromo-N-butan-2-yl-4-chloro-5-ethylidene-2-ethylsulfanylquinazolin-6-imine.
| Compound Name | (5Z)-7-bromo-N-butan-2-yl-4-chloro-5-ethylidene-2-ethylsulfanylquinazolin-6-imine |
|---|---|
| PubChem CID | 172596225 |
| Molecular Formula | C16H19BrClN3S |
| Molecular Weight | 400.77 g/mol |
| Exact Mass | 399.02 |
| IUPAC Name | (5Z)-7-bromo-N-butan-2-yl-4-chloro-5-ethylidene-2-ethylsulfanylquinazolin-6-imine |
| SMILES | C/C=C1C(=N\C(C)CC)\C(Br)=Cc2nc(SCC)nc(Cl)c2\1 |
| InChI | InChI=1S/C16H19BrClN3S/c1-5-9(4)19-14-10(6-2)13-12(8-11(14)17)20-16(22-7-3)21-15(13)18/h6,8-9H,5,7H2,1-4H3/b10-6-,19-14- |
| InChIKey | HVXBMSSCXVAANP-IKEDHZNGSA-N |
| XLogP | 5.63 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.77 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|