C15H16BrCl2N3 — CID 172596270
(5Z)-7-bromo-N-butan-2-yl-2,4-dichloro-5-ethylidene-8-methylquinazolin-6-imine (PubChem CID 172596270) has the molecular formula C15H16BrCl2N3 and a molecular weight of 389.12 g/mol. Its IUPAC name is (5Z)-7-bromo-N-butan-2-yl-2,4-dichloro-5-ethylidene-8-methylquinazolin-6-imine.
| Compound Name | (5Z)-7-bromo-N-butan-2-yl-2,4-dichloro-5-ethylidene-8-methylquinazolin-6-imine |
|---|---|
| PubChem CID | 172596270 |
| Molecular Formula | C15H16BrCl2N3 |
| Molecular Weight | 389.12 g/mol |
| Exact Mass | 386.99 |
| IUPAC Name | (5Z)-7-bromo-N-butan-2-yl-2,4-dichloro-5-ethylidene-8-methylquinazolin-6-imine |
| SMILES | C/C=C1C(=N\C(C)CC)\C(Br)=C(C)c2nc(Cl)nc(Cl)c2\1 |
| InChI | InChI=1S/C15H16BrCl2N3/c1-5-7(3)19-13-9(6-2)10-12(8(4)11(13)16)20-15(18)21-14(10)17/h6-7H,5H2,1-4H3/b9-6-,19-13- |
| InChIKey | XSZQPGQHKYLBDO-DHQJCBLHSA-N |
| XLogP | 5.57 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.12 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|