C17H23BrClN3S3 — CID 172596258
(5Z)-7-bromo-N-butan-2-yl-4-chloro-2-[ethyl-bis(sulfanyl)-λ4-sulfanyl]-5-ethylidene-8-methylquinazolin-6-imine (PubChem CID 172596258) has the molecular formula C17H23BrClN3S3 and a molecular weight of 480.95 g/mol. Its IUPAC name is (5Z)-7-bromo-N-butan-2-yl-4-chloro-2-[ethyl-bis(sulfanyl)-λ4-sulfanyl]-5-ethylidene-8-methylquinazolin-6-imine.
| Compound Name | (5Z)-7-bromo-N-butan-2-yl-4-chloro-2-[ethyl-bis(sulfanyl)-λ4-sulfanyl]-5-ethylidene-8-methylquinazolin-6-imine |
|---|---|
| PubChem CID | 172596258 |
| Molecular Formula | C17H23BrClN3S3 |
| Molecular Weight | 480.95 g/mol |
| Exact Mass | 478.99 |
| IUPAC Name | (5Z)-7-bromo-N-butan-2-yl-4-chloro-2-[ethyl-bis(sulfanyl)-λ4-sulfanyl]-5-ethylidene-8-methylquinazolin-6-imine |
| SMILES | C/C=C1C(=N\C(C)CC)\C(Br)=C(C)c2nc(S(S)(S)CC)nc(Cl)c2\1 |
| InChI | InChI=1S/C17H23BrClN3S3/c1-6-9(4)20-15-11(7-2)12-14(10(5)13(15)18)21-17(22-16(12)19)25(23,24)8-3/h7,9,23-24H,6,8H2,1-5H3/b11-7-,20-15- |
| InChIKey | XZYJKJIGGSJBGG-LMSVMBPSSA-N |
| XLogP | 6.79 |
| TPSA | 38.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.95 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|