C16H19BrClN3S3 — CID 172596440
(6-bromo-1-chloro-5,8,9-trimethyl-8,9-dihydropyrido[3,2-f]quinazolin-3-yl)-ethyl-bis(sulfanyl)-λ4-sulfane (PubChem CID 172596440) has the molecular formula C16H19BrClN3S3 and a molecular weight of 464.91 g/mol. Its IUPAC name is (6-bromo-1-chloro-5,8,9-trimethyl-8,9-dihydropyrido[3,2-f]quinazolin-3-yl)-ethyl-bis(sulfanyl)-λ4-sulfane.
| Compound Name | (6-bromo-1-chloro-5,8,9-trimethyl-8,9-dihydropyrido[3,2-f]quinazolin-3-yl)-ethyl-bis(sulfanyl)-λ4-sulfane |
|---|---|
| PubChem CID | 172596440 |
| Molecular Formula | C16H19BrClN3S3 |
| Molecular Weight | 464.91 g/mol |
| Exact Mass | 462.96 |
| IUPAC Name | (6-bromo-1-chloro-5,8,9-trimethyl-8,9-dihydropyrido[3,2-f]quinazolin-3-yl)-ethyl-bis(sulfanyl)-λ4-sulfane |
| SMILES | CCS(S)(S)c1nc(Cl)c2c3c(c(Br)c(C)c2n1)=NC(C)C(C)C=3 |
| InChI | InChI=1S/C16H19BrClN3S3/c1-5-24(22,23)16-20-13-8(3)12(17)14-10(11(13)15(18)21-16)6-7(2)9(4)19-14/h6-7,9,22-23H,5H2,1-4H3 |
| InChIKey | CFIPUSPJTNTPMA-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 38.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.91 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|