C15H16BrClN3PS — CID 172596083
(6-bromo-1-chloro-3-ethylsulfanyl-8,9-dimethyl-8,9-dihydropyrido[3,2-f]quinazolin-5-yl)phosphane (PubChem CID 172596083) has the molecular formula C15H16BrClN3PS and a molecular weight of 416.71 g/mol. Its IUPAC name is (6-bromo-1-chloro-3-ethylsulfanyl-8,9-dimethyl-8,9-dihydropyrido[3,2-f]quinazolin-5-yl)phosphane.
| Compound Name | (6-bromo-1-chloro-3-ethylsulfanyl-8,9-dimethyl-8,9-dihydropyrido[3,2-f]quinazolin-5-yl)phosphane |
|---|---|
| PubChem CID | 172596083 |
| Molecular Formula | C15H16BrClN3PS |
| Molecular Weight | 416.71 g/mol |
| Exact Mass | 414.97 |
| IUPAC Name | (6-bromo-1-chloro-3-ethylsulfanyl-8,9-dimethyl-8,9-dihydropyrido[3,2-f]quinazolin-5-yl)phosphane |
| SMILES | CCSc1nc(Cl)c2c3c(c(Br)c(P)c2n1)=NC(C)C(C)C=3 |
| InChI | InChI=1S/C15H16BrClN3PS/c1-4-22-15-19-12-9(14(17)20-15)8-5-6(2)7(3)18-11(8)10(16)13(12)21/h5-7H,4,21H2,1-3H3 |
| InChIKey | LHMVVIVLABXOCH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.71 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|