C31H51BrN4O2S — CID 172596667
1-[(5Z)-7-bromo-6-butan-2-ylimino-2-(2-butyl-2-methyloctoxy)-5-ethylidenequinazolin-4-yl]pyrrolidin-3-ol;sulfane (PubChem CID 172596667) has the molecular formula C31H51BrN4O2S and a molecular weight of 623.75 g/mol. Its IUPAC name is 1-[(5Z)-7-bromo-6-butan-2-ylimino-2-(2-butyl-2-methyloctoxy)-5-ethylidenequinazolin-4-yl]pyrrolidin-3-ol;sulfane.
| Compound Name | 1-[(5Z)-7-bromo-6-butan-2-ylimino-2-(2-butyl-2-methyloctoxy)-5-ethylidenequinazolin-4-yl]pyrrolidin-3-ol;sulfane |
|---|---|
| PubChem CID | 172596667 |
| Molecular Formula | C31H51BrN4O2S |
| Molecular Weight | 623.75 g/mol |
| Exact Mass | 622.29 |
| IUPAC Name | 1-[(5Z)-7-bromo-6-butan-2-ylimino-2-(2-butyl-2-methyloctoxy)-5-ethylidenequinazolin-4-yl]pyrrolidin-3-ol;sulfane |
| SMILES | C/C=C1C(=N\C(C)CC)\C(Br)=Cc2nc(OCC(C)(CCCC)CCCCCC)nc(N3CCC(O)C3)c2\1.S |
| InChI | InChI=1S/C31H49BrN4O2.H2S/c1-7-11-13-14-17-31(6,16-12-8-2)21-38-30-34-26-19-25(32)28(33-22(5)9-3)24(10-4)27(26)29(35-30)36-18-15-23(37)20-36;/h10,19,22-23,37H,7-9,11-18,20-21H2,1-6H3;1H2/b24-10-,33-28-; |
| InChIKey | WGQXMWHHWMTXCA-VQGRYYGHSA-N |
| XLogP | 8.10 |
| TPSA | 70.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.75 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|