C20H16N6S — CID 172597002
4-[9-methyl-6-[(4-methylphenyl)sulfanylamino]purin-8-yl]benzonitrile (PubChem CID 172597002) has the molecular formula C20H16N6S and a molecular weight of 372.46 g/mol. Its IUPAC name is 4-[9-methyl-6-[(4-methylphenyl)sulfanylamino]purin-8-yl]benzonitrile.
| Compound Name | 4-[9-methyl-6-[(4-methylphenyl)sulfanylamino]purin-8-yl]benzonitrile |
|---|---|
| PubChem CID | 172597002 |
| Molecular Formula | C20H16N6S |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 4-[9-methyl-6-[(4-methylphenyl)sulfanylamino]purin-8-yl]benzonitrile |
| SMILES | Cc1ccc(SNc2ncnc3c2nc(-c2ccc(C#N)cc2)n3C)cc1 |
| InChI | InChI=1S/C20H16N6S/c1-13-3-9-16(10-4-13)27-25-18-17-20(23-12-22-18)26(2)19(24-17)15-7-5-14(11-21)6-8-15/h3-10,12H,1-2H3,(H,22,23,25) |
| InChIKey | NGVHXRVAUHJPDU-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|