C28H48O3 — CID 172597907
(10R)-17-(7-hydroxy-6-methylheptan-2-yl)-16-methoxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 172597907) has the molecular formula C28H48O3 and a molecular weight of 432.69 g/mol. Its IUPAC name is (10R)-17-(7-hydroxy-6-methylheptan-2-yl)-16-methoxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (10R)-17-(7-hydroxy-6-methylheptan-2-yl)-16-methoxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 172597907 |
| Molecular Formula | C28H48O3 |
| Molecular Weight | 432.69 g/mol |
| Exact Mass | 432.36 |
| IUPAC Name | (10R)-17-(7-hydroxy-6-methylheptan-2-yl)-16-methoxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | COC1CC2C3CC=C4CC(O)CC[C@]4(C)C3CCC2(C)C1C(C)CCCC(C)CO |
| InChI | InChI=1S/C28H48O3/c1-18(17-29)7-6-8-19(2)26-25(31-5)16-24-22-10-9-20-15-21(30)11-13-27(20,3)23(22)12-14-28(24,26)4/h9,18-19,21-26,29-30H,6-8,10-17H2,1-5H3/t18?,19?,21?,22?,23?,24?,25?,26?,27-,28?/m0/s1 |
| InChIKey | CGDJIBFOHYJCBE-VJSHDOBQSA-N |
| XLogP | 5.99 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.69 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|