C20H28ClN5O2S — CID 172601278
7-(chloromethyl)-N-(1-methylsulfonylpiperidin-4-yl)-5-piperidin-1-yl-2,6-naphthyridin-3-amine (PubChem CID 172601278) has the molecular formula C20H28ClN5O2S and a molecular weight of 438.00 g/mol. Its IUPAC name is 7-(chloromethyl)-N-(1-methylsulfonylpiperidin-4-yl)-5-piperidin-1-yl-2,6-naphthyridin-3-amine.
| Compound Name | 7-(chloromethyl)-N-(1-methylsulfonylpiperidin-4-yl)-5-piperidin-1-yl-2,6-naphthyridin-3-amine |
|---|---|
| PubChem CID | 172601278 |
| Molecular Formula | C20H28ClN5O2S |
| Molecular Weight | 438.00 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 7-(chloromethyl)-N-(1-methylsulfonylpiperidin-4-yl)-5-piperidin-1-yl-2,6-naphthyridin-3-amine |
| SMILES | CS(=O)(=O)N1CCC(Nc2cc3c(N4CCCCC4)nc(CCl)cc3cn2)CC1 |
| InChI | InChI=1S/C20H28ClN5O2S/c1-29(27,28)26-9-5-16(6-10-26)23-19-12-18-15(14-22-19)11-17(13-21)24-20(18)25-7-3-2-4-8-25/h11-12,14,16H,2-10,13H2,1H3,(H,22,23) |
| InChIKey | QYMNOTJGACGPFQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.00 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|