C30H43N7O3 — CID 172601470
tert-butyl 4-[2-(2,7-dimethylpyrazolo[1,5-a]pyridin-5-yl)-4-oxopyrido[1,2-a][1,3,5]triazin-7-yl]-2-methylpiperazine-1-carboxylate;ethane (PubChem CID 172601470) has the molecular formula C30H43N7O3 and a molecular weight of 549.72 g/mol. Its IUPAC name is tert-butyl 4-[2-(2,7-dimethylpyrazolo[1,5-a]pyridin-5-yl)-4-oxopyrido[1,2-a][1,3,5]triazin-7-yl]-2-methylpiperazine-1-carboxylate;ethane.
| Compound Name | tert-butyl 4-[2-(2,7-dimethylpyrazolo[1,5-a]pyridin-5-yl)-4-oxopyrido[1,2-a][1,3,5]triazin-7-yl]-2-methylpiperazine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 172601470 |
| Molecular Formula | C30H43N7O3 |
| Molecular Weight | 549.72 g/mol |
| Exact Mass | 549.34 |
| IUPAC Name | tert-butyl 4-[2-(2,7-dimethylpyrazolo[1,5-a]pyridin-5-yl)-4-oxopyrido[1,2-a][1,3,5]triazin-7-yl]-2-methylpiperazine-1-carboxylate;ethane |
| SMILES | CC.CC.Cc1cc2cc(-c3nc(=O)n4cc(N5CCN(C(=O)OC(C)(C)C)C(C)C5)ccc4n3)cc(C)n2n1 |
| InChI | InChI=1S/C26H31N7O3.2C2H6/c1-16-11-21-13-19(12-17(2)33(21)29-16)23-27-22-8-7-20(15-32(22)24(34)28-23)30-9-10-31(18(3)14-30)25(35)36-26(4,5)6;2*1-2/h7-8,11-13,15,18H,9-10,14H2,1-6H3;2*1-2H3 |
| InChIKey | ANDJPWBHJWGCEO-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 97.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.72 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |