C49H39N2+ — CID 172603884
9-[(Z)-but-1-enyl]-12-[(2Z,4Z)-6-methylidene-1-triphenylen-2-yl-1-benzazocin-8-yl]-8-azoniatetracyclo[6.5.1.02,7.010,14]tetradeca-1(14),2,4,6,8,10,12-heptaene;ethane (PubChem CID 172603884) has the molecular formula C49H39N2+ and a molecular weight of 655.87 g/mol. Its IUPAC name is 9-[(Z)-but-1-enyl]-12-[(2Z,4Z)-6-methylidene-1-triphenylen-2-yl-1-benzazocin-8-yl]-8-azoniatetracyclo[6.5.1.02,7.010,14]tetradeca-1(14),2,4,6,8,10,12-heptaene;ethane.
| Compound Name | 9-[(Z)-but-1-enyl]-12-[(2Z,4Z)-6-methylidene-1-triphenylen-2-yl-1-benzazocin-8-yl]-8-azoniatetracyclo[6.5.1.02,7.010,14]tetradeca-1(14),2,4,6,8,10,12-heptaene;ethane |
|---|---|
| PubChem CID | 172603884 |
| Molecular Formula | C49H39N2+ |
| Molecular Weight | 655.87 g/mol |
| Exact Mass | 655.31 |
| IUPAC Name | 9-[(Z)-but-1-enyl]-12-[(2Z,4Z)-6-methylidene-1-triphenylen-2-yl-1-benzazocin-8-yl]-8-azoniatetracyclo[6.5.1.02,7.010,14]tetradeca-1(14),2,4,6,8,10,12-heptaene;ethane |
| SMILES | C=C1/C=C\C=C/N(c2ccc3c4ccccc4c4ccccc4c3c2)c2ccc(-c3cc4c5c(c3)-c3ccccc3[N+]5=C4/C=C\CC)cc21.CC |
| InChI | InChI=1S/C47H33N2.C2H6/c1-3-4-19-46-43-28-32(27-42-39-18-9-10-20-45(39)49(46)47(42)43)31-21-24-44-40(26-31)30(2)13-11-12-25-48(44)33-22-23-38-36-16-6-5-14-34(36)35-15-7-8-17-37(35)41(38)29-33;1-2/h4-29H,2-3H2,1H3;1-2H3/q+1;/b13-11-,19-4-,25-12-; |
| InChIKey | UMVCXADFYDKRCC-DUFNPUEDSA-N |
| XLogP | 13.66 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.87 |
| LogP ≤ 5 | 13.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|