C25H20N2 — CID 142355676
9-methyl-3-[(2Z,4Z)-6-methylidene-1-benzazocin-1-yl]carbazole (PubChem CID 142355676) has the molecular formula C25H20N2 and a molecular weight of 348.45 g/mol. Its IUPAC name is 9-methyl-3-[(2Z,4Z)-6-methylidene-1-benzazocin-1-yl]carbazole.
| Compound Name | 9-methyl-3-[(2Z,4Z)-6-methylidene-1-benzazocin-1-yl]carbazole |
|---|---|
| PubChem CID | 142355676 |
| Molecular Formula | C25H20N2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 9-methyl-3-[(2Z,4Z)-6-methylidene-1-benzazocin-1-yl]carbazole |
| SMILES | C=C1/C=C\C=C/N(c2ccc3c(c2)c2ccccc2n3C)c2ccccc21 |
| InChI | InChI=1S/C25H20N2/c1-18-9-7-8-16-27(25-13-6-3-10-20(18)25)19-14-15-24-22(17-19)21-11-4-5-12-23(21)26(24)2/h3-17H,1H2,2H3/b9-7-,16-8- |
| InChIKey | YBBGDZIEPCZTOS-BIHOSGGPSA-N |
| XLogP | 6.57 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |