C25H20N2 — CID 144511930
(4Z,6Z)-19-methyl-8-methylidene-3-phenyl-3,19-diazatetracyclo[10.7.0.02,9.013,18]nonadeca-1(12),2(9),4,6,10,13,15,17-octaene (PubChem CID 144511930) has the molecular formula C25H20N2 and a molecular weight of 348.45 g/mol. Its IUPAC name is (4Z,6Z)-19-methyl-8-methylidene-3-phenyl-3,19-diazatetracyclo[10.7.0.02,9.013,18]nonadeca-1(12),2(9),4,6,10,13,15,17-octaene.
| Compound Name | (4Z,6Z)-19-methyl-8-methylidene-3-phenyl-3,19-diazatetracyclo[10.7.0.02,9.013,18]nonadeca-1(12),2(9),4,6,10,13,15,17-octaene |
|---|---|
| PubChem CID | 144511930 |
| Molecular Formula | C25H20N2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | (4Z,6Z)-19-methyl-8-methylidene-3-phenyl-3,19-diazatetracyclo[10.7.0.02,9.013,18]nonadeca-1(12),2(9),4,6,10,13,15,17-octaene |
| SMILES | C=C1/C=C\C=C/N(c2ccccc2)c2c1ccc1c3ccccc3n(C)c21 |
| InChI | InChI=1S/C25H20N2/c1-18-10-8-9-17-27(19-11-4-3-5-12-19)25-20(18)15-16-22-21-13-6-7-14-23(21)26(2)24(22)25/h3-17H,1H2,2H3/b10-8-,17-9- |
| InChIKey | RQFYMVCUJGZEGI-OFEBMFTOSA-N |
| XLogP | 6.57 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |