C31H36ClFN2O4 — CID 172604925
2-[2-chloro-5-[2-[(4-hydroxy-4-methylcyclohexyl)amino]-1-phenylethyl]phenyl]-3-fluoro-4-(2-methoxyethoxy)benzamide (PubChem CID 172604925) has the molecular formula C31H36ClFN2O4 and a molecular weight of 555.09 g/mol. Its IUPAC name is 2-[2-chloro-5-[2-[(4-hydroxy-4-methylcyclohexyl)amino]-1-phenylethyl]phenyl]-3-fluoro-4-(2-methoxyethoxy)benzamide.
| Compound Name | 2-[2-chloro-5-[2-[(4-hydroxy-4-methylcyclohexyl)amino]-1-phenylethyl]phenyl]-3-fluoro-4-(2-methoxyethoxy)benzamide |
|---|---|
| PubChem CID | 172604925 |
| Molecular Formula | C31H36ClFN2O4 |
| Molecular Weight | 555.09 g/mol |
| Exact Mass | 554.23 |
| IUPAC Name | 2-[2-chloro-5-[2-[(4-hydroxy-4-methylcyclohexyl)amino]-1-phenylethyl]phenyl]-3-fluoro-4-(2-methoxyethoxy)benzamide |
| SMILES | COCCOc1ccc(C(N)=O)c(-c2cc(C(CNC3CCC(C)(O)CC3)c3ccccc3)ccc2Cl)c1F |
| InChI | InChI=1S/C31H36ClFN2O4/c1-31(37)14-12-22(13-15-31)35-19-25(20-6-4-3-5-7-20)21-8-10-26(32)24(18-21)28-23(30(34)36)9-11-27(29(28)33)39-17-16-38-2/h3-11,18,22,25,35,37H,12-17,19H2,1-2H3,(H2,34,36) |
| InChIKey | NUHCOOHFNVRBOD-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.09 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|