C26H25ClFNO3 — CID 172604754
2-[2-chloro-5-(2-oxo-1-phenylethyl)phenyl]-3-fluoro-4-(2-methoxyethoxy)benzonitrile;ethane (PubChem CID 172604754) has the molecular formula C26H25ClFNO3 and a molecular weight of 453.94 g/mol. Its IUPAC name is 2-[2-chloro-5-(2-oxo-1-phenylethyl)phenyl]-3-fluoro-4-(2-methoxyethoxy)benzonitrile;ethane.
| Compound Name | 2-[2-chloro-5-(2-oxo-1-phenylethyl)phenyl]-3-fluoro-4-(2-methoxyethoxy)benzonitrile;ethane |
|---|---|
| PubChem CID | 172604754 |
| Molecular Formula | C26H25ClFNO3 |
| Molecular Weight | 453.94 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 2-[2-chloro-5-(2-oxo-1-phenylethyl)phenyl]-3-fluoro-4-(2-methoxyethoxy)benzonitrile;ethane |
| SMILES | CC.COCCOc1ccc(C#N)c(-c2cc(C(C=O)c3ccccc3)ccc2Cl)c1F |
| InChI | InChI=1S/C24H19ClFNO3.C2H6/c1-29-11-12-30-22-10-8-18(14-27)23(24(22)26)19-13-17(7-9-21(19)25)20(15-28)16-5-3-2-4-6-16;1-2/h2-10,13,15,20H,11-12H2,1H3;1-2H3 |
| InChIKey | LVPAFHHWAXTORU-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.94 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|