C27H29ClFNO4 — CID 172604108
2-[2-chloro-5-[1-hydroxy-1-phenyl-2-(propan-2-ylamino)ethyl]phenyl]-3-fluoro-4-(2-methoxyethoxy)benzaldehyde (PubChem CID 172604108) has the molecular formula C27H29ClFNO4 and a molecular weight of 485.98 g/mol. Its IUPAC name is 2-[2-chloro-5-[1-hydroxy-1-phenyl-2-(propan-2-ylamino)ethyl]phenyl]-3-fluoro-4-(2-methoxyethoxy)benzaldehyde.
| Compound Name | 2-[2-chloro-5-[1-hydroxy-1-phenyl-2-(propan-2-ylamino)ethyl]phenyl]-3-fluoro-4-(2-methoxyethoxy)benzaldehyde |
|---|---|
| PubChem CID | 172604108 |
| Molecular Formula | C27H29ClFNO4 |
| Molecular Weight | 485.98 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | 2-[2-chloro-5-[1-hydroxy-1-phenyl-2-(propan-2-ylamino)ethyl]phenyl]-3-fluoro-4-(2-methoxyethoxy)benzaldehyde |
| SMILES | COCCOc1ccc(C=O)c(-c2cc(C(O)(CNC(C)C)c3ccccc3)ccc2Cl)c1F |
| InChI | InChI=1S/C27H29ClFNO4/c1-18(2)30-17-27(32,20-7-5-4-6-8-20)21-10-11-23(28)22(15-21)25-19(16-31)9-12-24(26(25)29)34-14-13-33-3/h4-12,15-16,18,30,32H,13-14,17H2,1-3H3 |
| InChIKey | IATJLESMJOPITQ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.98 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|