C31H33Cl2FN2O2 — CID 172605043
2-[2,4-dichloro-5-[2-[(4-methylcyclohexyl)amino]-1-phenylethyl]phenyl]-3-fluoro-4-(2-methoxyethoxy)benzonitrile (PubChem CID 172605043) has the molecular formula C31H33Cl2FN2O2 and a molecular weight of 555.52 g/mol. Its IUPAC name is 2-[2,4-dichloro-5-[2-[(4-methylcyclohexyl)amino]-1-phenylethyl]phenyl]-3-fluoro-4-(2-methoxyethoxy)benzonitrile.
| Compound Name | 2-[2,4-dichloro-5-[2-[(4-methylcyclohexyl)amino]-1-phenylethyl]phenyl]-3-fluoro-4-(2-methoxyethoxy)benzonitrile |
|---|---|
| PubChem CID | 172605043 |
| Molecular Formula | C31H33Cl2FN2O2 |
| Molecular Weight | 555.52 g/mol |
| Exact Mass | 554.19 |
| IUPAC Name | 2-[2,4-dichloro-5-[2-[(4-methylcyclohexyl)amino]-1-phenylethyl]phenyl]-3-fluoro-4-(2-methoxyethoxy)benzonitrile |
| SMILES | COCCOc1ccc(C#N)c(-c2cc(C(CNC3CCC(C)CC3)c3ccccc3)c(Cl)cc2Cl)c1F |
| InChI | InChI=1S/C31H33Cl2FN2O2/c1-20-8-11-23(12-9-20)36-19-26(21-6-4-3-5-7-21)24-16-25(28(33)17-27(24)32)30-22(18-35)10-13-29(31(30)34)38-15-14-37-2/h3-7,10,13,16-17,20,23,26,36H,8-9,11-12,14-15,19H2,1-2H3 |
| InChIKey | LBFNLRQAVGPYJF-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.52 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|