C22H13ClF3NO2 — CID 172604635
2-[2-chloro-5-(2-phenyloxiran-2-yl)phenyl]-4-(difluoromethoxy)-3-fluorobenzonitrile (PubChem CID 172604635) has the molecular formula C22H13ClF3NO2 and a molecular weight of 415.80 g/mol. Its IUPAC name is 2-[2-chloro-5-(2-phenyloxiran-2-yl)phenyl]-4-(difluoromethoxy)-3-fluorobenzonitrile.
| Compound Name | 2-[2-chloro-5-(2-phenyloxiran-2-yl)phenyl]-4-(difluoromethoxy)-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 172604635 |
| Molecular Formula | C22H13ClF3NO2 |
| Molecular Weight | 415.80 g/mol |
| Exact Mass | 415.06 |
| IUPAC Name | 2-[2-chloro-5-(2-phenyloxiran-2-yl)phenyl]-4-(difluoromethoxy)-3-fluorobenzonitrile |
| SMILES | N#Cc1ccc(OC(F)F)c(F)c1-c1cc(C2(c3ccccc3)CO2)ccc1Cl |
| InChI | InChI=1S/C22H13ClF3NO2/c23-17-8-7-15(22(12-28-22)14-4-2-1-3-5-14)10-16(17)19-13(11-27)6-9-18(20(19)24)29-21(25)26/h1-10,21H,12H2 |
| InChIKey | JNBUIXZECHEIOX-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.80 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|