C21H14BrF4N3O5S — CID 172605598
N-[(4-bromo-3-nitrophenyl)methyl]-N-(4-fluoro-2-methylsulfonylphenyl)-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 172605598) has the molecular formula C21H14BrF4N3O5S and a molecular weight of 576.32 g/mol. Its IUPAC name is N-[(4-bromo-3-nitrophenyl)methyl]-N-(4-fluoro-2-methylsulfonylphenyl)-6-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | N-[(4-bromo-3-nitrophenyl)methyl]-N-(4-fluoro-2-methylsulfonylphenyl)-6-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 172605598 |
| Molecular Formula | C21H14BrF4N3O5S |
| Molecular Weight | 576.32 g/mol |
| Exact Mass | 574.98 |
| IUPAC Name | N-[(4-bromo-3-nitrophenyl)methyl]-N-(4-fluoro-2-methylsulfonylphenyl)-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | CS(=O)(=O)c1cc(F)ccc1N(Cc1ccc(Br)c([N+](=O)[O-])c1)C(=O)c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C21H14BrF4N3O5S/c1-35(33,34)18-9-14(23)4-6-16(18)28(11-12-2-5-15(22)17(8-12)29(31)32)20(30)13-3-7-19(27-10-13)21(24,25)26/h2-10H,11H2,1H3 |
| InChIKey | BXXPOLYTUPNLBO-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 110.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.32 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|