C17H13F5N2O2 — CID 172606670
5,7-difluoro-2-[5-(trifluoromethyl)-2-pyridinyl]-1H-indole-3-carbaldehyde;methoxymethane (PubChem CID 172606670) has the molecular formula C17H13F5N2O2 and a molecular weight of 372.29 g/mol. Its IUPAC name is 5,7-difluoro-2-[5-(trifluoromethyl)-2-pyridinyl]-1H-indole-3-carbaldehyde;methoxymethane.
| Compound Name | 5,7-difluoro-2-[5-(trifluoromethyl)-2-pyridinyl]-1H-indole-3-carbaldehyde;methoxymethane |
|---|---|
| PubChem CID | 172606670 |
| Molecular Formula | C17H13F5N2O2 |
| Molecular Weight | 372.29 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 5,7-difluoro-2-[5-(trifluoromethyl)-2-pyridinyl]-1H-indole-3-carbaldehyde;methoxymethane |
| SMILES | COC.O=Cc1c(-c2ccc(C(F)(F)F)cn2)[nH]c2c(F)cc(F)cc12 |
| InChI | InChI=1S/C15H7F5N2O.C2H6O/c16-8-3-9-10(6-23)14(22-13(9)11(17)4-8)12-2-1-7(5-21-12)15(18,19)20;1-3-2/h1-6,22H;1-2H3 |
| InChIKey | JEOHOSJAUNHEMD-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.29 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|