C13H5Cl2F2NOS — CID 4519698
2-(2,5-dichlorothiophen-3-yl)-5,7-difluoro-1H-indole-3-carbaldehyde (PubChem CID 4519698) has the molecular formula C13H5Cl2F2NOS and a molecular weight of 332.16 g/mol. Its IUPAC name is 2-(2,5-dichlorothiophen-3-yl)-5,7-difluoro-1H-indole-3-carbaldehyde.
| Compound Name | 2-(2,5-dichlorothiophen-3-yl)-5,7-difluoro-1H-indole-3-carbaldehyde |
|---|---|
| PubChem CID | 4519698 |
| Molecular Formula | C13H5Cl2F2NOS |
| Molecular Weight | 332.16 g/mol |
| Exact Mass | 330.94 |
| IUPAC Name | 2-(2,5-dichlorothiophen-3-yl)-5,7-difluoro-1H-indole-3-carbaldehyde |
| SMILES | O=Cc1c(-c2cc(Cl)sc2Cl)[nH]c2c(F)cc(F)cc12 |
| InChI | InChI=1S/C13H5Cl2F2NOS/c14-10-3-7(13(15)20-10)11-8(4-19)6-1-5(16)2-9(17)12(6)18-11/h1-4,18H |
| InChIKey | OAPDGAQBEZBNLE-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.16 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|