C13H6Cl3NOS — CID 3823757
7-chloro-2-(2,5-dichlorothiophen-3-yl)-1H-indole-3-carbaldehyde (PubChem CID 3823757) has the molecular formula C13H6Cl3NOS and a molecular weight of 330.62 g/mol. Its IUPAC name is 7-chloro-2-(2,5-dichlorothiophen-3-yl)-1H-indole-3-carbaldehyde.
| Compound Name | 7-chloro-2-(2,5-dichlorothiophen-3-yl)-1H-indole-3-carbaldehyde |
|---|---|
| PubChem CID | 3823757 |
| Molecular Formula | C13H6Cl3NOS |
| Molecular Weight | 330.62 g/mol |
| Exact Mass | 328.92 |
| IUPAC Name | 7-chloro-2-(2,5-dichlorothiophen-3-yl)-1H-indole-3-carbaldehyde |
| SMILES | O=Cc1c(-c2cc(Cl)sc2Cl)[nH]c2c(Cl)cccc12 |
| InChI | InChI=1S/C13H6Cl3NOS/c14-9-3-1-2-6-8(5-18)11(17-12(6)9)7-4-10(15)19-13(7)16/h1-5,17H |
| InChIKey | IXAGVFNJJFLFTI-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.62 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|