C15H24F3NO2 — CID 172608939
(3E,5E)-7,7,7-trifluoro-3-[(E)-2-methoxyethenyl]-4-pentoxyhepta-3,5-dien-1-amine (PubChem CID 172608939) has the molecular formula C15H24F3NO2 and a molecular weight of 307.36 g/mol. Its IUPAC name is (3E,5E)-7,7,7-trifluoro-3-[(E)-2-methoxyethenyl]-4-pentoxyhepta-3,5-dien-1-amine.
| Compound Name | (3E,5E)-7,7,7-trifluoro-3-[(E)-2-methoxyethenyl]-4-pentoxyhepta-3,5-dien-1-amine |
|---|---|
| PubChem CID | 172608939 |
| Molecular Formula | C15H24F3NO2 |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | (3E,5E)-7,7,7-trifluoro-3-[(E)-2-methoxyethenyl]-4-pentoxyhepta-3,5-dien-1-amine |
| SMILES | CCCCCOC(/C=C/C(F)(F)F)=C(/C=C/OC)CCN |
| InChI | InChI=1S/C15H24F3NO2/c1-3-4-5-11-21-14(6-9-15(16,17)18)13(7-10-19)8-12-20-2/h6,8-9,12H,3-5,7,10-11,19H2,1-2H3/b9-6+,12-8+,14-13+ |
| InChIKey | OPKKTTBQIXPOBX-UWOQCTNXSA-N |
| XLogP | 4.07 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|