C11H17F2NO — CID 178109605
1-(2,6-dimethylcyclohexa-1,5-dien-1-yl)oxy-3,3-difluoropropan-1-amine (PubChem CID 178109605) has the molecular formula C11H17F2NO and a molecular weight of 217.26 g/mol. Its IUPAC name is 1-(2,6-dimethylcyclohexa-1,5-dien-1-yl)oxy-3,3-difluoropropan-1-amine.
| Compound Name | 1-(2,6-dimethylcyclohexa-1,5-dien-1-yl)oxy-3,3-difluoropropan-1-amine |
|---|---|
| PubChem CID | 178109605 |
| Molecular Formula | C11H17F2NO |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 1-(2,6-dimethylcyclohexa-1,5-dien-1-yl)oxy-3,3-difluoropropan-1-amine |
| SMILES | CC1=CCCC(C)=C1OC(N)CC(F)F |
| InChI | InChI=1S/C11H17F2NO/c1-7-4-3-5-8(2)11(7)15-10(14)6-9(12)13/h4,9-10H,3,5-6,14H2,1-2H3 |
| InChIKey | SDQWEASGBYPJFV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|