C7H14N2 — CID 172609166
[(2E,4Z)-hepta-2,4-dien-2-yl]hydrazine (PubChem CID 172609166) has the molecular formula C7H14N2 and a molecular weight of 126.20 g/mol. Its IUPAC name is [(2E,4Z)-hepta-2,4-dien-2-yl]hydrazine.
| Compound Name | [(2E,4Z)-hepta-2,4-dien-2-yl]hydrazine |
|---|---|
| PubChem CID | 172609166 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | [(2E,4Z)-hepta-2,4-dien-2-yl]hydrazine |
| SMILES | CC/C=C\C=C(/C)NN |
| InChI | InChI=1S/C7H14N2/c1-3-4-5-6-7(2)9-8/h4-6,9H,3,8H2,1-2H3/b5-4-,7-6+ |
| InChIKey | GENHEVSJDAWZIP-SCFJQAPRSA-N |
| XLogP | 1.32 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|